CAS 104246-28-8
:2-CHLORO-N-{4-[(PYRIMIDIN-2-YLAMINO)SULFONYL]PHENYL}ACETAMIDE
Description:
2-Chloro-N-{4-[(pyrimidin-2-ylamino)sulfonyl]phenyl}acetamide, with the CAS number 104246-28-8, is a chemical compound characterized by its complex structure, which includes a chloro group, an acetamide moiety, and a sulfonamide linkage to a pyrimidine derivative. This compound typically exhibits properties such as moderate solubility in polar solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the pyrimidine ring suggests possible interactions with biological targets, particularly in the realm of enzyme inhibition or receptor modulation. Its sulfonamide group may contribute to its pharmacological properties, as sulfonamides are known for their antibacterial and diuretic effects. The chloro substituent can influence the compound's reactivity and stability. Overall, this compound's unique structural features may lead to diverse applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific diseases.
Formula:C12H11ClN4O3S
InChI:InChI=1/C12H11ClN4O3S/c13-8-11(18)16-9-2-4-10(5-3-9)21(19,20)17-12-14-6-1-7-15-12/h1-7H,8H2,(H,16,18)(H,14,15,17)
SMILES:c1cnc(nc1)NS(=O)(=O)c1ccc(cc1)NC(=O)CCl
Synonyms:- acetamide, 2-chloro-N-[4-[(2-pyrimidinylamino)sulfonyl]phenyl]-
- 2-chloro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide
- 2-chloro-N-{4-[(pyrimidin-2-ylamino)sulfonyl]phenyl}acetamide
- 2-chloro-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]ethanamide
- 2-chloro-N-[4-(2-pyrimidinylsulfamoyl)phenyl]acetamide
- 2-chloro-N-(4-(N-(pyrimidin-2-yl)sulfamoyl)phenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.