CAS 104246-30-2

N-[4-[(Acetylamino)sulfonyl]phenyl]-3-chloropropanamide

Description:

N-[4-[(Acetylamino)sulfonyl]phenyl]-3-chloropropanamide, with the CAS number 104246-30-2, is a chemical compound characterized by its complex structure, which includes an acetylamino group and a sulfonyl moiety attached to a phenyl ring. This compound typically exhibits properties associated with amides, such as moderate solubility in polar solvents and potential reactivity under specific conditions. The presence of the chloropropanamide group suggests that it may participate in nucleophilic substitution reactions, while the sulfonamide functionality can influence its biological activity and solubility. The compound may also display specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure indicates potential applications in drug development, particularly in targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, as it may pose risks depending on its reactivity and toxicity profile. Overall, this compound represents a unique combination of functional groups that could be explored for various chemical and biological applications.

Formula: C₁₁H₁₃ClN₂O₄S

InChI: InChI=1S/C11H13ClN2O4S/c1-8(15)14-19(17,18)10-4-2-9(3-5-10)13-11(16)6-7-12/h2-5H,6-7H2,1H3,(H,13,16)(H,14,15)

InChI key: InChIKey=ZIDYNWALMOWJPS-UHFFFAOYSA-N

SMILES: S(NC(C)=O)(=O)(=O)C1=CC=C(NC(CCCl)=O)C=C1