CAS 10425-07-7

(4-Hydroxy-2-methylphenyl)phenylmethanone

Description:

(4-Hydroxy-2-methylphenyl)phenylmethanone, also known as benzophenone-4 or BP-4, is an organic compound characterized by its structure, which includes a hydroxyl group and a ketone functional group. This compound is typically a white to light yellow crystalline solid that is soluble in organic solvents but has limited solubility in water. It is primarily used as a UV filter in sunscreens and cosmetic products, providing protection against harmful ultraviolet radiation. The presence of the hydroxyl group enhances its ability to absorb UV light, making it effective in preventing skin damage. Additionally, it exhibits photostability, which means it maintains its effectiveness upon exposure to sunlight. The compound's molecular structure contributes to its chemical stability and reactivity, allowing it to interact with various biological systems. Safety assessments indicate that it has a low toxicity profile, but as with all chemical substances, proper handling and usage guidelines should be followed to minimize any potential risks.

Formula: C₁₄H₁₂O₂

InChI: InChI=1S/C14H12O2/c1-10-9-12(15)7-8-13(10)14(16)11-5-3-2-4-6-11/h2-9,15H,1H3

InChI key: InChIKey=XPCXDJJTFCXJIU-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)C=C(O)C=C1)C2=CC=CC=C2

Synonyms:

• (4-Hydroxy-2-methylphenyl)phenylmethanone
• Methanone, (4-hydroxy-2-methylphenyl)phenyl-
• Benzophenone, 4-hydroxy-2-methyl-
• 4-Hydroxy-2-methylbenzophenone
• (4-Hydroxy-2-methylphenyl)phenylketon