CAS 1042655-57-1

3,4-Difluoro-α-(3-methylbutyl)benzenemethanamine

Description:

3,4-Difluoro-α-(3-methylbutyl)benzenemethanamine is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with two fluorine atoms at the 3 and 4 positions, and an α-(3-methylbutyl) group attached to a methanamine moiety. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility and reactivity. The presence of fluorine atoms may enhance lipophilicity and alter the electronic properties of the molecule, potentially impacting its biological activity. Additionally, the branched alkyl group (3-methylbutyl) can affect steric hindrance and molecular interactions. As a relatively complex organic compound, it may be of interest in pharmaceutical research or materials science, although specific applications would depend on further studies regarding its biological activity and chemical behavior. Safety data and handling precautions should be considered, as with any chemical substance, particularly those with amine functionalities.

Formula: C₁₂H₁₇F₂N

InChI: InChI=1S/C12H17F2N/c1-8(2)3-6-12(15)9-4-5-10(13)11(14)7-9/h4-5,7-8,12H,3,6,15H2,1-2H3

InChI key: InChIKey=RODXHPBROCACEM-UHFFFAOYSA-N

SMILES: C(CCC(C)C)(N)C1=CC(F)=C(F)C=C1

Synonyms:

• 3,4-Difluoro-α-(3-methylbutyl)benzenemethanamine
• Benzenemethanamine, 3,4-difluoro-α-(3-methylbutyl)-