CymitQuimica logo

CAS 1042703-32-1

:

3,5-Difluoro-4-hydroxybenzeneacetic acid

Description:
3,5-Difluoro-4-hydroxybenzeneacetic acid, identified by its CAS number 1042703-32-1, is an organic compound characterized by the presence of a benzene ring substituted with two fluorine atoms and a hydroxyl group, along with an acetic acid moiety. This compound exhibits both acidic and phenolic properties due to the carboxylic acid and hydroxyl functional groups, respectively. The fluorine substituents can influence the compound's reactivity, polarity, and biological activity, often enhancing its lipophilicity and altering its interaction with biological targets. The presence of the hydroxyl group contributes to potential hydrogen bonding capabilities, which can affect solubility in polar solvents. Additionally, the compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its synthesis typically involves the introduction of fluorine atoms onto the benzene ring followed by functionalization to incorporate the acetic acid group. Overall, 3,5-Difluoro-4-hydroxybenzeneacetic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H6F2O3
InChI:InChI=1S/C8H6F2O3/c9-5-1-4(3-7(11)12)2-6(10)8(5)13/h1-2,13H,3H2,(H,11,12)
InChI key:InChIKey=QLSDQWOOQFFUHR-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC(F)=C(O)C(F)=C1
Synonyms:
  • Benzeneacetic acid, 3,5-difluoro-4-hydroxy-
  • 3,5-Difluoro-4-hydroxybenzeneacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.