
CAS 1042722-42-8
:4-Bromo-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one
Description:
4-Bromo-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a bicyclic framework. The presence of bromine and methoxy groups contributes to its unique reactivity and solubility properties. The bromine atom typically enhances the compound's electrophilic character, making it useful in various synthetic applications. The methoxy groups, which are electron-donating, can influence the compound's electronic properties and stability. This compound may exhibit biological activity, potentially serving as a lead compound in pharmaceutical research. Its molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the dihydro form indicates that it may exist in a saturated state, affecting its physical properties such as melting point and solubility in organic solvents. Overall, 4-Bromo-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one is of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C10H10BrNO3
InChI:InChI=1S/C10H10BrNO3/c1-14-7-3-5-6(4-12-10(5)13)8(11)9(7)15-2/h3H,4H2,1-2H3,(H,12,13)
InChI key:InChIKey=KEDCFOZIJJIKRG-UHFFFAOYSA-N
SMILES:BrC1=C2C(=CC(OC)=C1OC)C(=O)NC2
Synonyms:- 1H-Isoindol-1-one, 4-bromo-2,3-dihydro-5,6-dimethoxy-
- 4-Bromo-2,3-dihydro-5,6-dimethoxy-1H-isoindol-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.