CAS 1042735-18-1: 4-[[4-Amino-2-[(4-methylphenyl)amino]-5-thiazolyl]carbonyl]benzonitrile

Description:4-[[4-Amino-2-[(4-methylphenyl)amino]-5-thiazolyl]carbonyl]benzonitrile, with the CAS number 1042735-18-1, is a synthetic organic compound characterized by its complex molecular structure, which includes a thiazole ring, an amine group, and a nitrile functional group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the thiazole moiety suggests possible interactions with biological targets, which may contribute to its pharmacological properties. Additionally, the compound's structure indicates potential for hydrogen bonding and π-π stacking interactions, which can influence its reactivity and stability. Its synthesis often involves multi-step organic reactions, and it may be utilized in the development of therapeutic agents or as a chemical probe in biological studies. As with many compounds of this nature, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula:C₁₈H₁₄N₄OS

InChI:InChI=1S/C18H14N4OS/c1-11-2-8-14(9-3-11)21-18-22-17(20)16(24-18)15(23)13-6-4-12(10-19)5-7-13/h2-9H,20H2,1H3,(H,21,22)

InChI key:InChIKey=CUDLEXBIVZPJBU-UHFFFAOYSA-N

SMILES:N#CC1=CC=C(C=C1)C(=O)C=2SC(=NC2N)NC3=CC=C(C=C3)C

Synonyms:
Benzonitrile, 4-[[4-amino-2-[(4-methylphenyl)amino]-5-thiazolyl]carbonyl]-
4-[[4-Amino-2-[(4-methylphenyl)amino]-5-thiazolyl]carbonyl]benzonitrile
ABC 1183

Found 3 products.

Product data	Purity	Price range	Estimated delivery
ABC1183 REF: 54-BUP16352CAS: 1042735-18-1	98.52%	613.00 €	Wed 16 Apr 25
ABC-1183 REF: 3D-SRB73518CAS: 1042735-18-1	Min. 95%	To inquire	Tue 27 May 25
ABC1183 REF: TM-T23601CAS: 1042735-18-1	98.53%	To inquire	Tue 03 Jun 25