CAS 10428-19-0
:1,1,3,3-Tetrabutyl-1,3-dichlorodistannoxane
Description:
1,1,3,3-Tetrabutyl-1,3-dichlorodistannoxane is an organotin compound characterized by its unique structure, which includes two tin atoms bonded to oxygen and chlorine atoms, along with four butyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its stability and solubility in organic solvents. It exhibits properties typical of organotin compounds, such as potential biocidal activity and applications in polymer stabilization. The presence of butyl groups enhances its hydrophobic characteristics, making it useful in various industrial applications, including as a catalyst or stabilizer in the production of plastics and coatings. However, like many organotin compounds, it may pose environmental and health risks, leading to regulatory scrutiny. Its synthesis often involves the reaction of tin compounds with chlorinated species, and it is important to handle it with care due to potential toxicity. Overall, 1,1,3,3-Tetrabutyl-1,3-dichlorodistannoxane is a significant compound in organometallic chemistry with various applications, albeit with associated safety considerations.
Formula:C16H36Cl2OSn2
InChI:InChI=1S/4C4H9.2ClH.O.2Sn/c4*1-3-4-2;;;;;/h4*1,3-4H2,2H3;2*1H;;;/q;;;;;;;2*+1/p-2
InChI key:InChIKey=MWFOVBOCPFXQMF-UHFFFAOYSA-L
SMILES:O([Sn](CCCC)(CCCC)Cl)[Sn](CCCC)(CCCC)Cl
Synonyms:- 1,1,3,3-Tetrabutyl-1,3-dichlorodistannoxane
- Bis(dibutyltin chloride) oxide
- Tin, oxybis[dibutylchloro-
- Oxybis[dibutyltin chloride]
- Distannoxane, 1,1,3,3-tetrabutyl-1,3-dichloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
