CAS 10428-85-0

3-Oxaspiro[5.5]undecane-9-carboxylic acid

Description:

3-Oxaspiro[5.5]undecane-9-carboxylic acid is a bicyclic compound characterized by its unique spiro structure, which consists of a fused ring system featuring both a five-membered and a seven-membered ring. The presence of a carboxylic acid functional group contributes to its acidity and reactivity, making it a potential candidate for various chemical reactions, including esterification and amidation. The "oxa" in its name indicates the presence of an oxygen atom within the spiro framework, which can influence the compound's polarity and solubility in different solvents. This compound may exhibit interesting biological activities due to its structural complexity, and it could serve as a building block in organic synthesis or medicinal chemistry. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 3-Oxaspiro[5.5]undecane-9-carboxylic acid represents a fascinating example of spirocyclic chemistry with potential applications in various fields.

Formula: C₁₁H₁₈O₃

InChI: InChI=1S/C11H18O3/c12-10(13)9-1-3-11(4-2-9)5-7-14-8-6-11/h9H,1-8H2,(H,12,13)

InChI key: InChIKey=ZBFIZLGIVGJKLH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CCC2(CC1)CCOCC2

Synonyms:

• 3-Oxaspiro[5.5]undecane-9-carboxylic acid

3-Oxaspiro[5.5]undecane-9-carboxylic acid

CAS: 10428-85-0

Versatile small molecule scaffold

Formula: C₁₁H₁₈O₃

Purity: Min. 95%

Molecular weight: 198.26 g/mol

Ref: 3D-KAA42885