CAS 10429-30-8
:2-(3-DIMETHYLAMINO-PROPOXY)-BENZALDEHYDE
Description:
2-(3-Dimethylamino-propoxy)-benzaldehyde, with the CAS number 10429-30-8, is an organic compound characterized by its structure, which includes a benzaldehyde moiety substituted with a propoxy group that contains a dimethylamino functional group. This compound typically exhibits properties associated with both aromatic aldehydes and amines, such as potential reactivity in nucleophilic addition reactions due to the aldehyde functional group. The presence of the dimethylamino group may impart basicity and influence the compound's solubility in various solvents, often enhancing its interaction with biological systems. Additionally, the propoxy chain can affect the compound's lipophilicity, potentially impacting its pharmacokinetic properties if considered for medicinal applications. The compound may also exhibit fluorescence or other optical properties, making it of interest in various fields, including organic synthesis and materials science. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C12H17NO2
InChI:InChI=1/C12H17NO2/c1-13(2)8-5-9-15-12-7-4-3-6-11(12)10-14/h3-4,6-7,10H,5,8-9H2,1-2H3
SMILES:CN(C)CCCOc1ccccc1C=O
Synonyms:- Chembrdg-Bb 9013384
- Timtec-Bb Sbb011176
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
