CAS 104290-39-3
:CCI 103F
Description:
CCI 103F, with the CAS number 104290-39-3, is a chemical substance primarily used as a refrigerant. It is characterized by its low global warming potential and ozone depletion potential, making it an environmentally friendly alternative to traditional refrigerants. The substance typically exhibits a low boiling point, which allows it to function effectively in cooling applications. CCI 103F is non-flammable and has a relatively low toxicity profile, contributing to its safety in various industrial and commercial settings. Its chemical structure includes halogenated components, which enhance its stability and efficiency as a refrigerant. Additionally, CCI 103F is compatible with various lubricants and materials commonly used in refrigeration systems, ensuring its versatility in applications. Overall, CCI 103F represents a significant advancement in refrigerant technology, aligning with global efforts to reduce the environmental impact of cooling systems.
Formula:C9H9F6N3O4
InChI:InChI=1/C9H9F6N3O4/c10-8(11,12)6(9(13,14)15)22-4-5(19)3-17-2-1-16-7(17)18(20)21/h1-2,5-6,19H,3-4H2
SMILES:c1cn(CC(COC(C(F)(F)F)C(F)(F)F)O)c(n1)N(=O)=O
Synonyms:- 1H-Imidazole-1-ethanol, 2-nitro-alpha-((2,2,2-trifluoro-1-(trifluoromethyl)ethoxy)methyl)-
- 1-[(1,1,1,3,3,3-hexafluoropropan-2-yl)oxy]-3-(2-nitro-1H-imidazol-1-yl)propan-2-ol
- Cci 103F
- Cci-103F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.