CAS 104290-49-5
:5-Bromo-N-(1-methylethyl)-3-pyridinemethanamine
Description:
5-Bromo-N-(1-methylethyl)-3-pyridinemethanamine, with the CAS number 104290-49-5, is a chemical compound that features a pyridine ring substituted with a bromine atom and an isopropyl group. This compound is characterized by its amine functional group, which contributes to its basicity and potential reactivity in various chemical reactions. The presence of the bromine atom enhances its electrophilic properties, making it useful in synthetic organic chemistry, particularly in substitution reactions. The isopropyl group provides steric hindrance, which can influence the compound's reactivity and interactions with other molecules. This substance may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility and stability in different solvents can vary, depending on the specific conditions, such as pH and temperature. Overall, 5-Bromo-N-(1-methylethyl)-3-pyridinemethanamine is a versatile compound with potential applications in medicinal chemistry and organic synthesis.
Formula:C9H13BrN2
InChI:InChI=1S/C9H13BrN2/c1-7(2)12-5-8-3-9(10)6-11-4-8/h3-4,6-7,12H,5H2,1-2H3
InChI key:InChIKey=ATJVKVOAQAZHSW-UHFFFAOYSA-N
SMILES:C(NC(C)C)C=1C=C(Br)C=NC1
Synonyms:- [(5-Bromopyridin-3-yl)methyl](propan-2-yl)amine
- 3-Pyridinemethanamine, 5-bromo-N-(1-methylethyl)-
- 5-Bromo-N-(1-methylethyl)-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
