CAS 104291-82-9

Methyl 6-formyl-1H-indole-2-carboxylate

Description:

Methyl 6-formyl-1H-indole-2-carboxylate is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a formyl group (-CHO) at the 6-position and a carboxylate ester group (-COOCH3) at the 2-position, contributing to its reactivity and potential applications in organic synthesis. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of functional groups. The presence of the formyl group suggests that it can participate in various chemical reactions, such as condensation and oxidation, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, compounds with indole structures are often studied for their biological activities, including potential pharmaceutical applications. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₁H₉NO₃

InChI: InChI=1S/C11H9NO3/c1-15-11(14)10-5-8-3-2-7(6-13)4-9(8)12-10/h2-6,12H,1H3

InChI key: InChIKey=VSBOYUDCWORENC-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1NC=2C(C1)=CC=C(C=O)C2

Synonyms:

• Methyl 6-formyl-1H-indole-2-carboxylate
• 1H-Indole-2-carboxylic acid, 6-formyl-, methyl ester