CymitQuimica logo

CAS 104291-83-0

:

1H-Indole-2-carboxylic acid, 6-cyano-, methyl ester

Description:
1H-Indole-2-carboxylic acid, 6-cyano-, methyl ester, with CAS number 104291-83-0, is a chemical compound that belongs to the indole family, characterized by its bicyclic structure containing a fused benzene and pyrrole ring. This compound features a carboxylic acid group and a cyano group at specific positions on the indole ring, along with a methyl ester functional group. The presence of the cyano group contributes to its potential reactivity and biological activity. Typically, indole derivatives are known for their diverse pharmacological properties, including anti-inflammatory, antimicrobial, and anticancer activities. The methyl ester form indicates that the carboxylic acid is esterified, which can influence its solubility and reactivity. This compound may be utilized in various synthetic applications, particularly in medicinal chemistry for the development of new therapeutic agents. Its unique structural features make it a subject of interest in research focused on drug discovery and development.
Formula:C11H8N2O2
InChI:InChI=1S/C11H8N2O2/c1-15-11(14)10-5-8-3-2-7(6-12)4-9(8)13-10/h2-5,13H,1H3
InChI key:VDOVWALYWVUEQR-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC2=C(N1)C=C(C=C2)C#N
Found 4 products.