CAS 104294-61-3

Benzenemethanol, α-(1-aminoethyl)-α-methyl-, hydrochloride (1:1)

Description:

Benzenemethanol, α-(1-aminoethyl)-α-methyl-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its structural features that include a benzene ring, a methanol group, and an aminoethyl side chain. This compound typically exhibits properties associated with both aromatic and aliphatic functionalities, which can influence its solubility, reactivity, and biological activity. As a hydrochloride salt, it is generally more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the amino group suggests potential for interactions with biological systems, making it of interest in medicinal chemistry. Additionally, the compound may exhibit basic properties due to the amino group, which can participate in protonation and deprotonation reactions. Its specific applications and effects would depend on its interaction with biological targets, making it relevant in the study of pharmacology and drug design. Safety and handling considerations should be observed, as with all chemical substances, particularly those with biological activity.

Formula: C₁₀H₁₅NO·ClH

InChI: InChI=1S/C10H15NO.ClH/c1-8(11)10(2,12)9-6-4-3-5-7-9;/h3-8,12H,11H2,1-2H3;1H

InChI key: InChIKey=KLNDSWALQXWNPY-UHFFFAOYSA-N

SMILES: C(C(C)N)(C)(O)C1=CC=CC=C1.Cl

Synonyms:

• Benzenemethanol, α-(1-aminoethyl)-α-methyl-, hydrochloride (1:1)
• 3-Amino-2-phenylbutan-2-ol hydrochloride
• Benzyl alcohol, α-(1-aminoethyl)-α-methyl-, hydrochloride