CAS 104296-01-7
:6-Amino-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone
Description:
6-Amino-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone, with the CAS number 104296-01-7, is a chemical compound characterized by its pyrimidinone core structure, which features an amino group and a phenylmethylamino substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential solubility in polar solvents due to the presence of amino groups. Its molecular structure suggests that it may participate in hydrogen bonding, influencing its reactivity and interaction with biological systems. The presence of the phenylmethyl group can enhance lipophilicity, potentially affecting its pharmacokinetic properties. Compounds of this nature are often investigated for their biological activities, including potential roles as pharmaceuticals or in medicinal chemistry. The specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, 6-Amino-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone represents a class of compounds with diverse applications in research and development.
Formula:C11H12N4O
InChI:InChI=1S/C11H12N4O/c12-9-6-10(16)15-11(14-9)13-7-8-4-2-1-3-5-8/h1-6H,7H2,(H4,12,13,14,15,16)
InChI key:InChIKey=BXCOXGXFTAJMFB-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)C=2NC(N)=CC(=O)N2
Synonyms:- 4(1H)-Pyrimidinone, 6-amino-2-[(phenylmethyl)amino]-
- 4-Amino-2-benzylamino-6-hydroxypyrimidine
- 4-Pyrimidinol, 6-amino-2-benzylamino-
- 6-Amino-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone
- 4(3H)-Pyrimidinone, 6-amino-2-[(phenylmethyl)amino]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.