CymitQuimica logo

CAS 1042973-68-1

:

3,4-Dihydro-4-methyl-2H-1,4-benzoxazin-8-amine

Description:
3,4-Dihydro-4-methyl-2H-1,4-benzoxazin-8-amine is a chemical compound characterized by its unique bicyclic structure, which includes a benzoxazine ring. This compound features a dihydro configuration, indicating the presence of a saturated ring system, and a methyl group at the 4-position, contributing to its overall stability and reactivity. The amine functional group at the 8-position enhances its potential for hydrogen bonding and reactivity in various chemical reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and solvents used. The presence of both aromatic and aliphatic characteristics in its structure suggests potential applications in organic synthesis and materials science. As with many benzoxazine derivatives, it may also possess interesting thermal and mechanical properties, which could be explored for advanced material applications.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-11-5-6-12-9-7(10)3-2-4-8(9)11/h2-4H,5-6,10H2,1H3
InChI key:InChIKey=QNXQBHHHKHBBKT-UHFFFAOYSA-N
SMILES:NC1=C2C(N(C)CCO2)=CC=C1
Synonyms:
  • 2H-1,4-Benzoxazin-8-amine, 3,4-dihydro-4-methyl-
  • 3,4-Dihydro-4-methyl-2H-1,4-benzoxazin-8-amine
  • 8-Amino-2,3-dihydro-4-methyl-4H-benzo[1,4]oxazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.