CymitQuimica logo

CAS 1042981-21-4

:

1-(2-Methylimidazo[1,2-a]pyridin-5-yl)ethanone

Description:
1-(2-Methylimidazo[1,2-a]pyridin-5-yl)ethanone is a chemical compound characterized by its unique structure, which includes an imidazo[1,2-a]pyridine moiety substituted with a methyl group and an ethanone functional group. This compound is typically classified as a heterocyclic aromatic compound due to the presence of nitrogen atoms in its ring structure. It may exhibit properties such as moderate to high lipophilicity, which can influence its solubility in organic solvents and its potential biological activity. The presence of the imidazole ring suggests that it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, compounds of this type are often studied for their potential roles in biological systems, including their implications in mutagenicity and carcinogenicity, particularly in relation to food chemistry and the formation of heterocyclic amines during cooking processes. Overall, 1-(2-Methylimidazo[1,2-a]pyridin-5-yl)ethanone represents a significant compound of interest in both synthetic and medicinal chemistry.
Formula:C10H10N2O
InChI:InChI=1S/C10H10N2O/c1-7-6-12-9(8(2)13)4-3-5-10(12)11-7/h3-6H,1-2H3
InChI key:InChIKey=LQBCHDMNLVQFEY-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1N2C(=NC(C)=C2)C=CC1
Synonyms:
  • Ethanone, 1-(2-methylimidazo[1,2-a]pyridin-5-yl)-
  • 1-(2-Methylimidazo[1,2-a]pyridin-5-yl)ethanone
  • 1-[2-Methylimidazo[1,2-a]pyridin-5-yl]ethan-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.