CymitQuimica logo

CAS 104304-10-1

:

1-(2-bromoethyl)quinuclidin-1-ium bromide

Description:
1-(2-Bromoethyl)quinuclidin-1-ium bromide is a quaternary ammonium compound characterized by its unique structure, which includes a quinuclidine moiety and a bromoethyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols due to its ionic nature. The presence of the bromide ion contributes to its ionic characteristics, making it a good candidate for various chemical reactions, particularly in organic synthesis and medicinal chemistry. Its quinuclidine structure imparts potential biological activity, which may be explored in pharmacological applications. Additionally, the bromoethyl group can serve as a reactive site for further functionalization, allowing for the development of derivatives with tailored properties. Safety data should be consulted, as quaternary ammonium compounds can exhibit toxicity and environmental concerns. Overall, 1-(2-bromoethyl)quinuclidin-1-ium bromide is a versatile compound with applications in research and industry, particularly in the fields of organic synthesis and drug development.
Formula:C9H17Br2N
InChI:InChI=1/C9H17BrN.BrH/c10-4-8-11-5-1-9(2-6-11)3-7-11;/h9H,1-8H2;1H/q+1;/p-1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.