CAS 10431-99-9: 2-Isopropyl-2-oxazoline
Description:2-Isopropyl-2-oxazoline is a five-membered heterocyclic compound characterized by the presence of an oxazoline ring, which consists of both nitrogen and oxygen atoms. This compound features an isopropyl group attached to the nitrogen atom of the oxazoline, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a relatively low boiling point. 2-Isopropyl-2-oxazoline is known for its solubility in polar organic solvents and its reactivity, particularly in polymer chemistry, where it can serve as a monomer for the synthesis of various polymers through ring-opening polymerization. The compound exhibits moderate stability under standard conditions but can undergo hydrolysis in the presence of moisture, leading to the formation of isopropanol and other byproducts. Its applications extend to the fields of coatings, adhesives, and as a potential intermediate in organic synthesis. Safety data indicates that it should be handled with care, as it may cause irritation upon contact with skin or eyes.
Formula:C6H11NO
InChI:InChI=1S/C6H11NO/c1-5(2)6-7-3-4-8-6/h5H,3-4H2,1-2H3
InChI key:InChIKey=FVEZUCIZWRDMSJ-UHFFFAOYSA-N
SMILES:N1=C(OCC1)C(C)C
- Synonyms:
- 2-(Propan-2-Yl)-4,5-Dihydro-1,3-Oxazole
- 2-Isopropyl-4,5-dihydro-1,3-oxazole
- 2-Oxazoline, 2-isopropyl-
- 4,5-Dihydro-2-(1-methylethyl)oxazole
- Oxazole, 4,5-Dihydro-2-(1-Methylethyl)-
- 2-Isopropyl-2-oxazoline
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-Isopropyl-2-oxazoline
Ref: 3B-I0642
5g | 175.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
2-ISOPROPYL-2-OXAZOLINE
Ref: IN-DA003HHI
1g | 136.00 € | ||
5g | 314.00 € | ||
25g | To inquire | ||
100mg | 49.00 € | ||
250mg | 58.00 € |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Ref: 10-F723785
5g | To inquire |