CAS 104310-02-3

3-methyl-4-oxo-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine-1-carbaldehyde

Description:

3-Methyl-4-oxo-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine-1-carbaldehyde is a chemical compound that belongs to the benzodiazepine class, characterized by its fused benzene and diazepine rings. This compound features a methyl group at the 3-position and an aldehyde functional group at the 1-position, contributing to its reactivity and potential biological activity. The presence of the carbonyl group (4-oxo) indicates that it may participate in various chemical reactions, such as nucleophilic additions. The tetrahydro structure suggests that it is a saturated derivative, which can influence its solubility and stability. This compound may exhibit pharmacological properties, as many benzodiazepines are known for their effects on the central nervous system, including anxiolytic, sedative, and anticonvulsant activities. Its specific applications and effects would depend on further research and characterization, including studies on its synthesis, reactivity, and biological interactions. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₁H₁₂N₂O₂

InChI: InChI=1/C11H12N2O2/c1-8-6-13(7-14)10-5-3-2-4-9(10)12-11(8)15/h2-5,7-8H,6H2,1H3,(H,12,15)

SMILES: CC1CN(C=O)c2ccccc2N=C1O

Synonyms:

• 1H-1,5-benzodiazepine-1-carboxaldehyde, 2,3,4,5-tetrahydro-3-methyl-4-oxo-