CAS 104314-04-7

α-[(4-Fluorophenyl)methylene]-2-thiopheneacetic acid

Description:

α-[(4-Fluorophenyl)methylene]-2-thiopheneacetic acid, with the CAS number 104314-04-7, is an organic compound characterized by its unique structure that includes a thiophene ring and a fluorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of the carboxylic acid functional group. The fluorine atom in the para position of the phenyl ring can influence the compound's electronic properties, potentially enhancing its reactivity or altering its interaction with biological targets. The thiophene moiety contributes to the compound's aromatic character and may also impart specific biological activities. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development or as a building block in organic synthesis. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound represents a fascinating intersection of aromatic and heterocyclic chemistry.

Formula: C₁₃H₉FO₂S

InChI: InChI=1S/C13H9FO2S/c14-10-5-3-9(4-6-10)8-11(13(15)16)12-2-1-7-17-12/h1-8H,(H,15,16)

InChI key: InChIKey=SSDFXAHSMOGNIW-UHFFFAOYSA-N

SMILES: C(=CC1=CC=C(F)C=C1)(C(O)=O)C2=CC=CS2

Synonyms:

• (2Z)-3-(4-fluorophenyl)-2-(thiophen-2-yl)prop-2-enoate
• (2Z)-3-(4-fluorophenyl)-2-(thiophen-2-yl)prop-2-enoic acid
• 2-Thiopheneacetic acid, α-[(4-fluorophenyl)methylene]-
• 3-(4-Fluorophenyl)-2-Thiophen-2-Ylprop-2-Enoate
• α-[(4-Fluorophenyl)methylene]-2-thiopheneacetic acid

3-(4-Fluorophenyl)-2-(thiophen-2-yl)acrylic acid

CAS: 104314-04-7

Formula: C₁₃H₉FO₂S

Molecular weight: 248.2728

Ref: IN-DA008ZF4