CAS 104318-58-3
:Poly(m-toluidine)
Description:
Poly(m-toluidine) is a conducting polymer derived from the polymerization of m-toluidine, an aromatic amine. This substance exhibits several notable characteristics, including electrical conductivity, which can be tuned through doping processes. It typically appears as a dark-colored powder or film and is soluble in various organic solvents, making it versatile for different applications. The polymer's structure features repeating units of m-toluidine, which contribute to its unique electronic properties. Poly(m-toluidine) is known for its stability and can be processed into films or coatings, making it suitable for use in sensors, actuators, and electronic devices. Additionally, it demonstrates good thermal stability and can withstand a range of environmental conditions. Its ability to undergo redox reactions allows it to be used in energy storage applications, such as batteries and supercapacitors. Overall, poly(m-toluidine) is a significant material in the field of organic electronics and materials science due to its conductive properties and adaptability in various technological applications.
Formula:(C7H9N)x
InChI:InChI=1S/C7H9N/c1-6-3-2-4-7(8)5-6/h2-5H,8H2,1H3
InChI key:InChIKey=JJYPMNFTHPTTDI-UHFFFAOYSA-N
SMILES:CC1=CC(N)=CC=C1
Synonyms:- Poly(m-methylaniline)
- Poly(3-methylaniline)
- m-Toluidine homopolymer
- 3-aminotoluene polymer
- Benzenamine, 3-methyl-, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
