CAS 10432-39-0

2-(1-Phenylpropylidene)propanedinitrile

Description:

2-(1-Phenylpropylidene)propanedinitrile, with the CAS number 10432-39-0, is an organic compound characterized by its unique structure, which includes a phenyl group and two cyano (nitrile) functional groups. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the nitrile groups, which can participate in various chemical reactions, including nucleophilic additions and polymerization processes. The compound may exhibit moderate to high toxicity, necessitating careful handling and appropriate safety measures in laboratory settings. Its applications can span across organic synthesis, where it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, the compound's physical properties, such as boiling point and solubility, can vary based on environmental conditions and the presence of other solvents. Overall, 2-(1-Phenylpropylidene)propanedinitrile is a versatile compound with significant implications in chemical research and industry.

Formula: C₁₂H₁₀N₂

InChI: InChI=1S/C12H10N2/c1-2-12(11(8-13)9-14)10-6-4-3-5-7-10/h3-7H,2H2,1H3

InChI key: InChIKey=KCJFQVHZCRRSIG-UHFFFAOYSA-N

SMILES: C(=C(C#N)C#N)(CC)C1=CC=CC=C1

Synonyms:

• Malononitrile, (α-ethylbenzylidene)-
• Propanedinitrile, 2-(1-phenylpropylidene)-
• 2-(1-Phenylpropylidene)propanedinitrile
• Propanedinitrile, (1-phenylpropylidene)-
• (1-Phenylpropylidene)malononitrile