CAS 104333-09-7

4-AMINO-2-(HYDROXYMETHYL)BENZENOL

Description:

4-Amino-2-(hydroxymethyl)benzenol, also known by its CAS number 104333-09-7, is an organic compound characterized by the presence of an amino group (-NH2) and a hydroxymethyl group (-CH2OH) attached to a benzene ring. This compound typically exhibits properties associated with both amines and phenolic compounds, such as solubility in polar solvents and potential reactivity in various chemical reactions. The amino group can participate in hydrogen bonding and nucleophilic substitution reactions, while the hydroxymethyl group can enhance solubility and reactivity. The presence of these functional groups suggests that the compound may have applications in pharmaceuticals, dyes, or as an intermediate in organic synthesis. Additionally, the compound's structure may influence its biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and potential hazards, as with any chemical substance.

Formula: C₇H₉NO₂

InChI: InChI=1/C7H9NO2/c8-6-1-2-7(10)5(3-6)4-9/h1-3,9-10H,4,8H2

SMILES: c1cc(c(cc1N)CO)O

Synonyms:

• 4-Amino-2-(Hydroxymethyl)Phenol

4-Amino-2-(hydroxymethyl)phenol

CAS: 104333-09-7

Formula: C₇H₉NO₂

Color and Shape: Solid

Molecular weight: 139.1519

Ref: IN-DA007Y6Y

4-Amino-2-(hydroxymethyl)benzenol

CAS: 104333-09-7

4-Amino-2-(hydroxymethyl)benzenol is a multilayer, which is synthesized in the copper complex. It has synergistic effects with amodiaquine, and can be used to treat blastomycosis. The parameters of 4-Amino-2-(hydroxymethyl)benzenol are dependent on the conditions where it was synthesised.

Formula: C₇H₉NO₂

Purity: Min. 95%

Molecular weight: 139.16 g/mol

Ref: 3D-EEA33309