
CAS 104338-25-2
:4,4-Dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile
Description:
4,4-Dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile, with the CAS number 104338-25-2, is a chemical compound characterized by its unique spirocyclic structure, which features a combination of a spiro carbon framework and a nitrile functional group. This compound typically exhibits a moderate level of polarity due to the presence of the carbonitrile group, which can influence its solubility in various organic solvents. The spiro structure contributes to its rigidity and may affect its reactivity and interaction with biological systems. Additionally, the presence of two methyl groups at the 4-position can enhance steric hindrance, potentially influencing its chemical behavior and stability. Such compounds may be of interest in synthetic organic chemistry and medicinal chemistry due to their potential biological activities and applications in drug development. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-9(2)5-3-4-6-10(9)8(7-11)12-10/h8H,3-6H2,1-2H3
InChI key:InChIKey=RAMVUTRPFJGQOR-UHFFFAOYSA-N
SMILES:C(#N)C1C2(O1)C(C)(C)CCCC2
Synonyms:- 4,4-Dimethyl-1-oxaspiro[2.5]octane-2-carbonitrile
- 1-Oxaspiro[2.5]octane-2-carbonitrile, 4,4-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.