CAS 104338-28-5
:β-Methoxy-2-methylbenzeneethanamine
Description:
β-Methoxy-2-methylbenzeneethanamine, also known by its CAS number 104338-28-5, is an organic compound characterized by the presence of a methoxy group and an ethylamine functional group attached to a methyl-substituted aromatic ring. This compound typically exhibits properties common to aromatic amines, such as moderate solubility in organic solvents and potential reactivity due to the amine group. The methoxy substituent can influence the compound's electronic properties, potentially affecting its reactivity and interaction with other chemical species. β-Methoxy-2-methylbenzeneethanamine may be of interest in various fields, including medicinal chemistry and materials science, due to its structural features that could contribute to biological activity or serve as a building block in synthetic pathways. As with many organic compounds, safety considerations should be taken into account, including handling and storage, as well as potential environmental impacts. Further studies would be necessary to fully elucidate its properties and applications.
Formula:C10H15NO
InChI:InChI=1S/C10H15NO/c1-8-5-3-4-6-9(8)10(7-11)12-2/h3-6,10H,7,11H2,1-2H3
InChI key:InChIKey=UVYUPSLNKTZNDR-UHFFFAOYSA-N
SMILES:C(CN)(OC)C1=C(C)C=CC=C1
Synonyms:- 2-Methoxy-2-(2-methylphenyl)ethanamine
- 2-Methoxy-2-(2-methylphenyl)ethan-1-amine
- Phenethylamine, β-methoxy-o-methyl-
- β-Methoxy-2-methylbenzeneethanamine
- Benzeneethanamine, β-methoxy-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.