CAS 104338-29-6

4-Ethoxy-2-ethylbenzenamine

Description:

4-Ethoxy-2-ethylbenzenamine, with the CAS number 104338-29-6, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with an ethoxy group and an ethyl group, along with an amino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the ethoxy group enhances its hydrophobic characteristics, while the amino group can participate in various chemical reactions, including nucleophilic substitutions. 4-Ethoxy-2-ethylbenzenamine may be used in the synthesis of dyes, pharmaceuticals, or agrochemicals, reflecting its potential utility in various chemical applications. Its physical properties, such as melting point, boiling point, and density, would depend on the specific molecular interactions and the arrangement of substituents on the benzene ring. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₀H₁₅NO

InChI: InChI=1S/C10H15NO/c1-3-8-7-9(12-4-2)5-6-10(8)11/h5-7H,3-4,11H2,1-2H3

InChI key: InChIKey=RWKBLWAGZOGSLH-UHFFFAOYSA-N

SMILES: C(C)C1=CC(OCC)=CC=C1N

Synonyms:

• 2-Ethyl-4-ethoxyaniline
• p-Phenetidine, 2-ethyl-
• Benzenamine, 4-ethoxy-2-ethyl-
• 4-Ethoxy-2-ethylbenzenamine