CAS 104344-75-4

3-(BENZOTHIAZOL-2-YLAMINO)-PROPIONIC ACID

Description:

3-(Benzothiazol-2-ylamino)-propionic acid, with the CAS number 104344-75-4, is an organic compound characterized by its unique structure that includes a benzothiazole moiety and an amino acid functional group. This compound typically exhibits properties such as solubility in polar solvents, which is common for amino acids and their derivatives. The presence of the benzothiazole ring contributes to its potential biological activity, as benzothiazoles are known for their roles in pharmaceuticals and agrochemicals. The amino group allows for interactions typical of amino acids, such as hydrogen bonding and participation in peptide formation. Additionally, the carboxylic acid group imparts acidic characteristics, making it capable of donating protons in solution. This compound may be of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its stability, reactivity, and interaction with biological systems would be key areas for further investigation in research and development contexts.

Formula: C₁₀H₉N₂O₂S

InChI: InChI=1/C10H10N2O2S/c13-9(14)5-6-11-10-12-7-3-1-2-4-8(7)15-10/h1-4H,5-6H2,(H,11,12)(H,13,14)/p-1

SMILES: c1ccc2c(c1)[nH]c(=NCCC(=O)[O-])s2

Synonyms:

• beta-Alanine, N-2-benzothiazolyl- (9CI)
• 3-(1,3-Benzothiazol-2-Ylamino)Propanoate

3-(Benzo[d]thiazol-2-ylamino)propanoic acid

CAS: 104344-75-4

Formula: C₁₀H₁₀N₂O₂S

Molecular weight: 222.2636

Ref: IN-DA008SC9

3-(Benzothiazol-2-ylamino)-propionic acid

CAS: 104344-75-4

Versatile small molecule scaffold

Formula: C₁₀H₁₀N₂O₂S

Purity: Min. 95%

Molecular weight: 222.27 g/mol

Ref: 3D-EEA34475