CAS 104350-18-7
:Benzenamine, 3-chloro-, homopolymer
Description:
Benzenamine, 3-chloro-, homopolymer, also known as 3-chloroaniline homopolymer, is a synthetic polymer derived from the polymerization of 3-chloroaniline monomers. This substance exhibits characteristics typical of aromatic amines, including good thermal stability and resistance to chemical degradation. The presence of chlorine substituents enhances its reactivity, making it suitable for various applications in the production of dyes, pigments, and other organic compounds. The polymer's structure contributes to its mechanical strength and potential use in coatings and adhesives. Additionally, due to the amine functional group, it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions. However, safety considerations are paramount, as aromatic amines can be toxic and potentially carcinogenic. Proper handling and disposal protocols are essential when working with this substance to mitigate health risks. Overall, 3-chloroaniline homopolymer is a versatile material with applications in multiple industrial sectors, but it requires careful management due to its chemical properties.
Formula:(C6H6ClN)x
InChI:InChI=1S/C6H6ClN/c7-5-2-1-3-6(8)4-5/h1-4H,8H2
InChI key:InChIKey=PNPCRKVUWYDDST-UHFFFAOYSA-N
SMILES:ClC1=CC(N)=CC=C1
Synonyms:- Benzenamine, 3-chloro-, homopolymer
- Poly(m-chloroaniline)
- m-Chloroaniline polymer
- Poly(3-chloroaniline)
- m-Chloroaniline homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
