CymitQuimica logo

CAS 1043593-59-4

:

2-Bromo-3-thiophenecarboxylic acid hydrazide

Description:
2-Bromo-3-thiophenecarboxylic acid hydrazide is an organic compound characterized by the presence of a bromine atom, a thiophene ring, and a hydrazide functional group. This compound features a thiophene moiety, which is a five-membered aromatic ring containing sulfur, contributing to its unique chemical properties and potential reactivity. The presence of the bromine atom enhances its electrophilic character, making it suitable for various substitution reactions. The hydrazide functional group (-CONH-NH2) indicates that the compound can participate in further chemical transformations, such as condensation reactions, which are valuable in synthetic organic chemistry. Additionally, the carboxylic acid component suggests potential acidity and the ability to form salts or esters. Overall, 2-Bromo-3-thiophenecarboxylic acid hydrazide is of interest in medicinal chemistry and materials science due to its structural features, which may impart biological activity or facilitate the development of novel compounds. Its specific applications and reactivity would depend on the context of its use in research or industrial settings.
Formula:C5H5BrN2OS
InChI:InChI=1S/C5H5BrN2OS/c6-4-3(1-2-10-4)5(9)8-7/h1-2H,7H2,(H,8,9)
InChI key:InChIKey=MNGHMNIFQHWWDM-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=C(Br)SC=C1
Synonyms:
  • 2-Bromo-3-thiophenecarboxylic acid hydrazide
  • 3-Thiophenecarboxylic acid, 2-bromo-, hydrazide
  • 2-Bromothiophene-3-carbohydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.