CAS 1043601-95-1

6-Ethyl-1H-indole-3-carbonitrile

Description:

6-Ethyl-1H-indole-3-carbonitrile is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of an ethyl group at the 6-position and a cyano group at the 3-position contributes to its unique chemical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to its hydrophobic indole core. The cyano group introduces a polar functional group, which can enhance its reactivity and potential interactions in various chemical environments. 6-Ethyl-1H-indole-3-carbonitrile may be of interest in medicinal chemistry and material science due to its potential biological activity and utility in synthesizing other complex molecules. Its reactivity can be influenced by the electron-donating nature of the ethyl group and the electron-withdrawing nature of the cyano group, making it a versatile building block in organic synthesis. As with many indole derivatives, it may exhibit fluorescence properties, which can be useful in various applications, including biological imaging and sensor development.

Formula: C₁₁H₁₀N₂

InChI: InChI=1S/C11H10N2/c1-2-8-3-4-10-9(6-12)7-13-11(10)5-8/h3-5,7,13H,2H2,1H3

InChI key: InChIKey=GDYQHMSJRANFGV-UHFFFAOYSA-N

SMILES: C(#N)C=1C=2C(=CC(CC)=CC2)NC1

Synonyms:

• 1H-Indole-3-carbonitrile, 6-ethyl-
• 6-Ethyl-1H-indole-3-carbonitrile