CAS 104373-85-5: 2-(4-pyridin-2-ylpiperazin-1-yl)propanoic acid
Description:2-(4-pyridin-2-ylpiperazin-1-yl)propanoic acid, identified by its CAS number 104373-85-5, is a chemical compound characterized by its unique structure that includes a propanoic acid moiety linked to a piperazine ring substituted with a pyridine group. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of both basic nitrogen atoms in the piperazine and the carboxylic acid functional group. It may display biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or psychiatric conditions. The presence of the pyridine ring can contribute to its ability to interact with various biological targets, while the piperazine moiety may enhance its pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug design, although specific physical and chemical properties would need to be determined through experimental methods.
Formula:C12H17N3O2
InChI:InChI=1/C12H17N3O2/c1-10(12(16)17)14-6-8-15(9-7-14)11-4-2-3-5-13-11/h2-5,10H,6-9H2,1H3,(H,16,17)
- Synonyms:
- 1-Piperazinepropionic acid, 4-(2-pyridinyl)-
- 4-(2-Pyridinyl)-1-piperazinepropionic acid
- Brn 5562499
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 1-Piperazinepropanoicacid, 4-(2-pyridinyl)- REF: IN-DA007HXZCAS: 104373-85-5 | 95% | To inquire | Wed 26 Mar 25 |
![]() | 3-(4-(Pyridin-2-yl)piperazin-1-yl)propanoic acid REF: 10-F695080CAS: 104373-85-5 | 95% | To inquire | Mon 07 Apr 25 |
![]() | 3-(4-Pyridin-2-yl-piperazin-1-yl)-propionic acid REF: 3D-EEA37385CAS: 104373-85-5 | Min. 95% | - - - | Discontinued product |

1-Piperazinepropanoicacid, 4-(2-pyridinyl)-
Ref: IN-DA007HXZ
1g | 303.00 € | ||
5g | To inquire | ||
250mg | 159.00 € |

3-(4-(Pyridin-2-yl)piperazin-1-yl)propanoic acid
Ref: 10-F695080
1g | To inquire | ||
250mg | To inquire |

3-(4-Pyridin-2-yl-piperazin-1-yl)-propionic acid
Ref: 3D-EEA37385
5g | Discontinued | Request information |