CAS 104386-68-7
:methyl 4-chloro-3-hydroxy-5-methylsulfanyl-thiophene-2-carboxylate
Description:
Methyl 4-chloro-3-hydroxy-5-methylsulfanyl-thiophene-2-carboxylate is a chemical compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. This compound features several functional groups, including a carboxylate ester (methyl ester), a hydroxyl group, and a chloro substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the methylsulfanyl group enhances its nucleophilicity, making it useful in various chemical reactions. The chloro group can serve as a leaving group in substitution reactions, while the hydroxyl group may participate in hydrogen bonding, influencing solubility and reactivity. This compound is of interest in medicinal chemistry and materials science due to its unique structural features, which may impart specific biological activities or facilitate the development of novel materials. Its properties, such as solubility, stability, and reactivity, can vary based on the solvent and environmental conditions, making it a versatile compound in research and industrial applications.
Formula:C7H7ClO3S2
InChI:InChI=1/C7H7ClO3S2/c1-11-6(10)5-4(9)3(8)7(12-2)13-5/h9H,1-2H3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.