CymitQuimica logo

CAS 104386-89-2

:

6,6',12'-trimethoxy-2'-methyl-1,2,3,4-tetradehydrooxyacanthan-7-ol

Description:
6,6',12'-trimethoxy-2'-methyl-1,2,3,4-tetradehydrooxyacanthan-7-ol, with the CAS number 104386-89-2, is a complex organic compound characterized by its unique molecular structure, which includes multiple methoxy groups and a tetradehydro configuration. This compound is part of a larger class of natural products, often exhibiting significant biological activity. The presence of methoxy groups typically enhances solubility and can influence the compound's reactivity and interaction with biological targets. The tetradehydro structure suggests a degree of unsaturation, which may contribute to its stability and reactivity. Additionally, the hydroxyl group in the structure can participate in hydrogen bonding, affecting its physical properties such as melting point and solubility in various solvents. Compounds like this are often studied for their potential pharmacological properties, including anti-inflammatory or antimicrobial activities. However, specific data regarding its toxicity, environmental impact, and detailed biological effects would require further investigation through empirical studies.
Formula:C36H34N2O6
InChI:InChI=1/C36H34N2O6/c1-38-14-12-23-18-30(41-3)32-20-26(23)28(38)16-22-7-10-29(40-2)31(17-22)43-25-8-5-21(6-9-25)15-27-34-24(11-13-37-27)19-33(42-4)35(39)36(34)44-32/h5-11,13,17-20,28,39H,12,14-16H2,1-4H3/t28-/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.