CAS 104387-15-7

Yuanhunine

Description:

Yuanhunine, with the CAS number 104387-15-7, is a chemical compound that belongs to the class of alkaloids, which are naturally occurring organic compounds that mostly contain basic nitrogen atoms. Alkaloids are known for their diverse pharmacological properties and can be derived from various plant sources. Yuanhunine is characterized by its complex molecular structure, which contributes to its biological activity. It has been studied for its potential therapeutic effects, including anti-inflammatory and analgesic properties. The compound's solubility, stability, and reactivity can vary depending on environmental conditions such as pH and temperature. As with many alkaloids, Yuanhunine may exhibit a range of effects on biological systems, making it a subject of interest in medicinal chemistry and pharmacology. However, detailed studies on its specific mechanisms of action, toxicity, and potential applications are essential for understanding its full profile and utility in various fields, including drug development and natural product research.

Formula: C₂₁H₂₅NO₄

InChI: InChI=1S/C21H25NO4/c1-12-14-5-6-17(23)21(26-4)16(14)11-22-8-7-13-9-18(24-2)19(25-3)10-15(13)20(12)22/h5-6,9-10,12,20,23H,7-8,11H2,1-4H3/t12-,20+/m0/s1

InChI key: InChIKey=PVYYNJAXBCIMNG-FKIZINRSSA-N

SMILES: C[C@@H]1[C@@]2(C=3C(=CC(OC)=C(OC)C3)CCN2CC=4C1=CC=C(O)C4OC)[H]

Synonyms:

• Yuanhunine
• (+)-O10-Demethylcorydaline
• 6H-Dibenzo[a,g]quinolizin-10-ol, 5,8,13,13a-tetrahydro-2,3,9-trimethoxy-13-methyl-, (13S,13aR)-
• 6H-Dibenzo[a,g]quinolizin-10-ol, 5,8,13,13a-tetrahydro-2,3,9-trimethoxy-13-methyl-, (13S-trans)-
• (13S,13aR)-5,8,13,13a-Tetrahydro-2,3,9-trimethoxy-13-methyl-6H-dibenzo[a,g]quinolizin-10-ol

Yuanhunine

CAS: 104387-15-7

Yuanhunine is a bioactive compound that is classified as an alkaloid. It is derived from natural sources, specifically extracted from certain medicinal plants. The mode of action of Yuanhunine involves interaction with various neurological pathways, potentially influencing neurotransmitter activity, which suggests its utility in modulating central nervous system functions.

Formula: C₂₁H₂₅NO₄

Purity: Min. 95%

Molecular weight: 355.40 g/mol

Ref: 3D-EEA38715