CAS 104390-83-2
:3-PHTHALIMIDOAZETIDINE
Description:
3-Phthalimidoazetidine, identified by its CAS number 104390-83-2, is a chemical compound characterized by its unique structural features, which include a phthalimide moiety attached to an azetidine ring. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, contributing to its potential reactivity and stability. The presence of the phthalimide group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. Additionally, azetidine, being a four-membered saturated ring, can exhibit strain, influencing its reactivity and interactions with other chemical species. The compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural characteristics that can facilitate interactions with biological targets. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, 3-phthalimidoazetidine represents an interesting compound for further research in synthetic and medicinal chemistry.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c14-10-8-3-1-2-4-9(8)11(15)13(10)7-5-12-6-7/h1-4,7,12H,5-6H2
SMILES:c1ccc2c(c1)C(=O)N(C1CNC1)C2=O
Synonyms:- 2-(3-Azetidinyl)-1H-isoindol-1,3(2H)-dione
- 2-azetidin-3-yl-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Phthalimidoazetidine
CAS:Controlled ProductFormula:C11H10N2O2Color and Shape:NeatMolecular weight:202.21
