CymitQuimica logo

CAS 1043902-88-0

:

N-Methoxy-N-methyl[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide

Description:
N-Methoxy-N-methyl[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide is a chemical compound characterized by its unique structure, which includes a triazole ring fused to a pyridine moiety. This compound features a methoxy group and a methyl group attached to the nitrogen atoms of the triazole, contributing to its potential biological activity. The presence of the carboxamide functional group enhances its solubility and reactivity, making it a candidate for various applications in medicinal chemistry. The compound's molecular structure suggests it may exhibit properties such as antimicrobial, antifungal, or anticancer activities, although specific biological effects would depend on further empirical studies. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many heterocyclic compounds, N-Methoxy-N-methyl[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide may also serve as a scaffold for the development of new pharmaceuticals, highlighting its significance in drug discovery and development.
Formula:C9H10N4O2
InChI:InChI=1S/C9H10N4O2/c1-12(15-2)9(14)7-3-4-8-10-6-11-13(8)5-7/h3-6H,1-2H3
InChI key:InChIKey=YTGDSUMZQXJWIQ-UHFFFAOYSA-N
SMILES:C(N(OC)C)(=O)C1=CN2C(C=C1)=NC=N2
Synonyms:
  • [1,2,4]Triazolo[1,5-a]pyridine-6-carboxamide, N-methoxy-N-methyl-
  • N-Methoxy-N-methyl[1,2,4]triazolo[1,5-a]pyridine-6-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.