CAS 1043903-19-0

[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid

Description:

[1,2,4]Triazolo[1,5-a]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its fused triazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a carboxylic acid functional group, influencing its acidity and reactivity. It is known for its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of nitrogen atoms in the triazole and pyridine rings can enhance its ability to form hydrogen bonds, which is crucial for interactions with biological targets. Additionally, the compound may exhibit solubility in polar solvents due to the carboxylic acid group, while its aromatic nature can contribute to stability and electronic properties. Its structural features may also allow for various synthetic modifications, enabling the exploration of derivatives with enhanced pharmacological profiles. Overall, [1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid represents a versatile scaffold in organic and medicinal chemistry.

Formula: C₇H₅N₃O₂

InChI: InChI=1S/C7H5N3O2/c11-7(12)5-1-2-6-8-4-9-10(6)3-5/h1-4H,(H,11,12)

SMILES: c1cc2ncnn2cc1C(=O)O

[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid

CAS: 1043903-19-0

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.1335

Ref: IN-DA0038D1

[1,2,4]Triazolo[1,5-a]pyridine-6-carboxylic acid

CAS: 1043903-19-0

[1,2,4]Triazolo[1,5-a]pyridine-6-carboxylic acid

Purity: 98%

Molecular weight: 163.13g/mol

Ref: 54-OR81569

[1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid

CAS: 1043903-19-0

Formula: C₇H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 163.136

Ref: 10-F092142

[1,2,4]Triazolo[1,5-a]pyridine-6-carboxylic Acid

Controlled Product

CAS: 1043903-19-0

Applications [1,2,4]triazolo[1,5-a]pyridine-6-carboxylic acid (cas# 1043903-19-0) is a useful research chemical.

Formula: C₇H₅N₃O₂

Color and Shape: Neat

Molecular weight: 163.13

Ref: TR-T795823