CAS 104391-52-8

Ethyl 4,5-dichloro-2-methoxybenzoate

Description:

Ethyl 4,5-dichloro-2-methoxybenzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid. It features a methoxy group (-OCH3) and two chlorine atoms substituted at the 4 and 5 positions of the aromatic ring, contributing to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic esters. Ethyl 4,5-dichloro-2-methoxybenzoate may exhibit biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. Its synthesis often involves the reaction of 4,5-dichloro-2-methoxybenzoic acid with ethanol in the presence of an acid catalyst. As with many chlorinated compounds, it is important to handle this substance with care due to potential environmental and health impacts associated with chlorinated organic compounds.

Formula: C₁₀H₁₀Cl₂O₃

InChI: InChI=1S/C10H10Cl2O3/c1-3-15-10(13)6-4-7(11)8(12)5-9(6)14-2/h4-5H,3H2,1-2H3

InChI key: InChIKey=WFXDEAHMHIEECE-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=C(OC)C=C(Cl)C(Cl)=C1

Synonyms:

• Ethyl 4,5-dichloro-2-methoxybenzoate
• Benzoic acid, 4,5-dichloro-2-methoxy-, ethyl ester
• 4,5-Dichloro-2-methoxybenzoic acid ethyl ester