
CAS 1043920-65-5
:3-Bromo-2,4,5,6-tetrahydro-2-methylcyclopentapyrazole
Description:
3-Bromo-2,4,5,6-tetrahydro-2-methylcyclopentapyrazole is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a cyclopentane and a pyrazole moiety. The presence of a bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations. This compound features a tetrahydro configuration, indicating that it contains saturated carbon atoms, which contributes to its stability and solubility in organic solvents. The methyl group attached to the cyclopentane ring enhances its lipophilicity, potentially influencing its biological activity and interaction with other molecules. Due to its structural complexity, this compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 3-Bromo-2,4,5,6-tetrahydro-2-methylcyclopentapyrazole represents a versatile scaffold for further chemical exploration and potential applications in drug development.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-10-7(8)5-3-2-4-6(5)9-10/h2-4H2,1H3
InChI key:InChIKey=NZOHXUPPFVGHAW-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NN1C)CCC2
Synonyms:- 3-Bromo-2-methyl-2,4,5,6-tetrahydrocyclopenta[c]pyrazole
- Cyclopentapyrazole, 3-bromo-2,4,5,6-tetrahydro-2-methyl-
- 3-Bromo-2-methyl-2H,4H,5H,6H-cyclopenta[c]pyrazole
- 3-Bromo-2,4,5,6-tetrahydro-2-methylcyclopentapyrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.