CAS 104395-86-0: 1-(5-Methyl-2-pyridinyl)piperazine
Description:1-(5-Methyl-2-pyridinyl)piperazine, with the CAS number 104395-86-0, is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 5-methyl-2-pyridinyl group attached to one of the nitrogen atoms of the piperazine, contributing to its unique properties. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the pyridine ring imparts basicity to the molecule, allowing it to participate in various chemical reactions, including those involving nucleophilic substitution. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology, particularly in the development of pharmaceuticals targeting neurological or psychiatric conditions. Its structure allows for potential interactions with neurotransmitter systems, which could be explored in drug design. As with many piperazine derivatives, it may also serve as a scaffold for further chemical modifications to enhance its efficacy or selectivity in biological applications.
Formula:C10H15N3
InChI:InChI=1/C10H15N3/c1-9-2-3-10(12-8-9)13-6-4-11-5-7-13/h2-3,8,11H,4-7H2,1H3
- Synonyms:
- Piperazine, 1-(5-methyl-2-pyridinyl)- (9CI)
- 1-(5-Methylpyridin-2-Yl)Piperazine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Piperazine, 1-(5-methyl-2-pyridinyl)- REF: IN-DA00HACACAS: 104395-86-0 | - - - | To inquire | Thu 27 Mar 25 |
 | 1-(5-Methyl-2-pyridinyl)piperazine REF: 54-OR904676CAS: 104395-86-0 | 97% | 253.00 €~959.00 € | Thu 03 Apr 25 |
 | 1-(5-Methyl-2-pyridinyl)piperazine REF: TR-M329280CAS: 104395-86-0 | - - - | 1,136.00 € | Wed 07 May 25 |
 | 1-(5-Methyl-2-pyridinyl)piperazine REF: 10-F076148CAS: 104395-86-0 | 95.0% | - - - | Discontinued product |
 | 1-(5-Methylpyridin-2-yl)piperazine REF: 3D-FM140346CAS: 104395-86-0 | Min. 95% | - - - | Discontinued product |
Ref: IN-DA00HACA
| Undefined size | To inquire |
1-(5-Methyl-2-pyridinyl)piperazine
Ref: 54-OR904676
| 1g | 253.00 € | ||
| 5g | 684.00 € | ||
| 10g | 959.00 € |
1-(5-Methyl-2-pyridinyl)piperazine
Controlled ProductRef: TR-M329280
| 5g | 1,136.00 € |
Ref: 10-F076148
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information |
1-(5-Methylpyridin-2-yl)piperazine
Ref: 3D-FM140346
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
