CAS 104397-80-0
:2,4,6-trimethoxyphenylacetic acid
Description:
2,4,6-Trimethoxyphenylacetic acid is an organic compound characterized by its phenylacetic acid structure, which features three methoxy groups (-OCH3) attached to the aromatic ring at the 2, 4, and 6 positions. This substitution pattern enhances its lipophilicity and may influence its biological activity. The compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its aromatic nature. It possesses acidic properties due to the carboxylic acid functional group (-COOH), allowing it to participate in various chemical reactions, including esterification and amidation. The presence of methoxy groups can also affect the compound's reactivity and interaction with biological targets, making it of interest in medicinal chemistry and pharmacology. Additionally, its unique structure may contribute to specific pharmacological effects, although detailed studies would be necessary to elucidate its biological mechanisms and potential applications. Overall, 2,4,6-trimethoxyphenylacetic acid is a compound of interest for further research in both synthetic and medicinal chemistry.
Formula:C11H14O5
InChI:InChI=1/C11H14O5/c1-14-7-4-9(15-2)8(6-11(12)13)10(5-7)16-3/h4-5H,6H2,1-3H3,(H,12,13)
SMILES:COc1cc(c(CC(=O)O)c(c1)OC)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,4,6-Trimethoxyphenylacetic Acid
CAS:Formula:C11H14O5Purity:95%Color and Shape:SolidMolecular weight:226.2259(2,4,6-Trimethoxyphenyl)acetic acid
CAS:(2,4,6-Trimethoxyphenyl)acetic acid is a fine chemical that can be used as a versatile building block in the synthesis of other compounds. It is also a useful intermediate for research chemicals and reaction components. (2,4,6-Trimethoxyphenyl)acetic acid is used to synthesize speciality chemicals such as polymers and pharmaceuticals. It is also an important reagent in organic synthesis. This compound has been shown to have high quality and can be used as an additive in paints and coatings.
Formula:C11H14O5Purity:Min. 95%Color and Shape:PowderMolecular weight:226.23 g/mol


