
CAS 104405-58-5
:1,2,4-Triazine-3,5-diamine
Description:
1,2,4-Triazine-3,5-diamine, with the CAS number 104405-58-5, is a heterocyclic organic compound characterized by its triazine ring structure, which contains three nitrogen atoms and three carbon atoms. This compound features amino groups (-NH2) at the 3 and 5 positions of the triazine ring, contributing to its potential reactivity and ability to form hydrogen bonds. It is typically a crystalline solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino groups. The compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and ability to act as a building block for more complex molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on environmental conditions and the presence of other functional groups. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C3H5N5
InChI:InChI=1S/C3H5N5/c4-2-1-6-8-3(5)7-2/h1H,(H4,4,5,7,8)
InChI key:InChIKey=RDPMHJJAUKOOIS-UHFFFAOYSA-N
SMILES:NC1=NC(N)=NN=C1
Synonyms:- 1,2,4-Triazine-3,5-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.