CAS 104409-41-8
:2'-deoxy-2'-methyleneadenosine
Description:
2'-Deoxy-2'-methyleneadenosine (CAS 104409-41-8) is a modified nucleoside that features a methylene group at the 2' position of the ribose sugar, replacing the hydroxyl group typically found in adenosine. This structural modification imparts unique biochemical properties, making it a valuable compound in biochemical research and drug development. The presence of the methylene group enhances the stability of the nucleoside against enzymatic degradation, which is particularly advantageous in therapeutic applications. Additionally, 2'-deoxy-2'-methyleneadenosine can influence nucleic acid interactions and has been studied for its potential role in inhibiting certain enzymes, such as adenosine deaminase. Its ability to mimic natural nucleosides while providing increased resistance to metabolic breakdown makes it a useful tool in the study of nucleic acid metabolism and signaling pathways. Overall, this compound exemplifies the importance of structural modifications in the development of nucleoside analogs for various scientific and medical applications.
Formula:C11H13N5O3
InChI:InChI=1/C11H13N5O3/c1-5-8(18)6(2-17)19-11(5)16-4-15-7-9(12)13-3-14-10(7)16/h3-4,6,8,11,17-18H,1-2H2,(H2,12,13,14)/t6-,8+,11-/m1/s1
Synonyms:- MdAdo
- Adenosine, 2'-deoxy-2'-methylene-
- 2'-Deoxy-2'-Methylideneadenosine
- 2'-Deoxy-2'-methyleneadenosine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2'-Deoxy-2'-methyleneadenosine
CAS:<p>2'-Deoxy-2'-methyleneadenosine is a potential mechanism for the treatment of cancer. It has been shown to be active against the murine leukemia cell line, L1210, and to cause inactivation of the cells. This drug inhibits cellular RNA synthesis by binding to either the ribonucleoside or deoxyribonucleoside pools in the cell and preventing their conversion into nucleotides. 2'-Deoxy-2'-methyleneadenosine has also been shown to be an effective inhibitor of gamma-aminobutyric acid (GABA) uptake and cross-resistance with other drugs that are GABA uptake inhibitors.</p>Formula:C11H13N5O3Purity:Min. 95%Molecular weight:263.25 g/mol
