CymitQuimica logo

CAS 10441-36-8

:

[(6-hydroxynaphthalen-2-yl)oxy]acetic acid

Description:
[(6-hydroxynaphthalen-2-yl)oxy]acetic acid, with the CAS number 10441-36-8, is an organic compound characterized by its naphthalene derivative structure, which includes a hydroxyl group and an ether linkage. This compound features a naphthalene ring substituted at the 2-position with an ether group connected to an acetic acid moiety. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity, particularly in hydrogen bonding interactions. The carboxylic acid functional group in the acetic acid portion provides acidic properties, allowing for potential ionization in aqueous solutions. This compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Its structural features suggest potential applications in organic synthesis, as well as in the development of materials or as intermediates in various chemical processes. Overall, [(6-hydroxynaphthalen-2-yl)oxy]acetic acid is a compound of interest due to its unique structural characteristics and potential utility in various fields.
Formula:C12H10O4
InChI:InChI=1/C12H10O4/c13-10-3-1-9-6-11(16-7-12(14)15)4-2-8(9)5-10/h1-6,13H,7H2,(H,14,15)
SMILES:c1cc(cc2ccc(cc12)OCC(=O)O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.