CAS 10441-45-9

2-(2-HYDROXY-1-NAPHTHYL)ACETIC ACID

Description:

2-(2-Hydroxy-1-naphthyl)acetic acid, also known as naproxen, is a non-steroidal anti-inflammatory drug (NSAID) characterized by its ability to reduce inflammation, pain, and fever. This compound features a naphthalene ring substituted with a hydroxyl group and an acetic acid moiety, contributing to its pharmacological properties. It exhibits moderate solubility in water and is more soluble in organic solvents, which is typical for aromatic compounds. The presence of the hydroxyl group enhances its reactivity and potential for hydrogen bonding, influencing its biological activity and interaction with enzymes. The compound is often utilized in the treatment of various inflammatory conditions, including arthritis and musculoskeletal disorders. Its mechanism of action primarily involves the inhibition of cyclooxygenase enzymes, leading to decreased synthesis of prostaglandins, which are mediators of inflammation and pain. Additionally, 2-(2-hydroxy-1-naphthyl)acetic acid has been studied for its potential antioxidant properties, further expanding its therapeutic applications.

Formula: C₁₂H₁₀O₃

InChI: InChI=1/C12H10O3/c13-11-6-5-8-3-1-2-4-9(8)10(11)7-12(14)15/h1-6,13H,7H2,(H,14,15)

SMILES: c1ccc2c(c1)ccc(c2CC(=O)O)O

Synonyms:

• (2-Hydroxynaphth-1-yl)acetic acid
• (2-Hydroxynaphthalen-1-Yl)Acetic Acid

(2-Hydroxynaphth-1-yl)acetic acid

CAS: 10441-45-9

(2-Hydroxynaphth-1-yl)acetic acid

Purity: ≥95%

Molecular weight: 202.21g/mol

Ref: 54-OR15204