CAS 10441-46-0
:6-Hydroxy-2-naphthaleneacetic acid
Description:
6-Hydroxy-2-naphthaleneacetic acid, with the CAS number 10441-46-0, is an organic compound that belongs to the class of naphthalene derivatives. It features a naphthalene ring structure substituted with a hydroxyl group and an acetic acid moiety. This compound is typically characterized by its solid state at room temperature and exhibits moderate solubility in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The compound is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, where it may act as a plant growth regulator or a biochemical agent. Its chemical properties include the ability to undergo typical organic reactions such as esterification and oxidation. Additionally, the presence of both aromatic and aliphatic functional groups contributes to its reactivity and interaction with biological systems. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H10O3
InChI:InChI=1S/C12H10O3/c13-11-4-3-9-5-8(6-12(14)15)1-2-10(9)7-11/h1-5,7,13H,6H2,(H,14,15)
InChI key:InChIKey=YNECZMXVHIGGSP-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC2=C(C=C1)C=C(O)C=C2
Synonyms:- 2-(6-Hydroxynaphthalen-2-yl)acetic acid
- 6-Hydroxy-2-naphthaleneacetic acid
- 2-Naphthaleneacetic acid, 6-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
6-Hydroxy-2-naphthaleneacetic Acid
CAS:<p>Applications A metabolite of Nabumetone.<br>References Nobilis, M., et al.: J., Pharm., Biomed., Anal., 32, 641 (2003),<br></p>Formula:C12H10O3Color and Shape:NeatMolecular weight:202.21


