CAS 10442-48-5

2-(4-Iodophenoxy)propanoic acid

Description:

2-(4-Iodophenoxy)propanoic acid, with the CAS number 10442-48-5, is an organic compound characterized by its unique structure, which includes a propanoic acid moiety linked to a 4-iodophenoxy group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the iodine atom in the phenoxy group can influence its reactivity and biological activity, making it a subject of interest in medicinal chemistry. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Its synthesis often involves the reaction of appropriate phenolic and carboxylic acid derivatives, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and infrared spectroscopy to confirm its structure and purity. Overall, 2-(4-Iodophenoxy)propanoic acid represents a valuable compound in chemical research and development.

Formula: C₉H₉IO₃

InChI: InChI=1S/C9H9IO3/c1-6(9(11)12)13-8-4-2-7(10)3-5-8/h2-6H,1H3,(H,11,12)

InChI key: InChIKey=ITUIVIPEOVLCML-UHFFFAOYSA-N

SMILES: O(C(C(O)=O)C)C1=CC=C(I)C=C1

Synonyms:

• Propanoic acid, 2-(4-iodophenoxy)-
• (RS)-2-(4-Iodophenoxy)propionic acid
• 2-(4-Iodophenoxy)propanoic acid
• Propionic acid, 2-(p-iodophenoxy)-, (±)-
• Propanoic acid, 2-(4-iodophenoxy)-, (±)-

2-(4-iodophenoxy)propanoic acid

CAS: 10442-48-5

Formula: C₉H₉IO₃

Molecular weight: 292.072

Ref: 10-F428823