CAS 104430-66-2

N-Acetyl-1,6-anhydro-β-muramic acid

Description:

N-Acetyl-1,6-anhydro-β-muramic acid is a chemical compound that plays a significant role in the structure of bacterial cell walls, particularly in peptidoglycan. It is a derivative of muramic acid, which is an essential component of the peptidoglycan layer that provides structural integrity to bacterial cells. This compound features an acetyl group and an anhydro structure, contributing to its unique properties. It is characterized by its ability to form hydrogen bonds due to the presence of hydroxyl and carbonyl groups, which can influence its solubility and reactivity. N-Acetyl-1,6-anhydro-β-muramic acid is typically studied in the context of microbiology and biochemistry, particularly regarding its role in bacterial growth and the development of antibiotics. Its molecular structure allows it to participate in various biochemical interactions, making it a subject of interest in research related to bacterial pathogenesis and cell wall synthesis. Additionally, its CAS number, 104430-66-2, serves as a unique identifier for regulatory and safety information.

Formula: C₁₁H₁₇NO₇

InChI: InChI=1S/C11H17NO7/c1-4(10(15)16)18-9-7(12-5(2)13)11-17-3-6(19-11)8(9)14/h4,6-9,11,14H,3H2,1-2H3,(H,12,13)(H,15,16)/t4-,6-,7-,8-,9-,11-/m1/s1

InChI key: InChIKey=ZFEGYUMHFZOYIY-YVNCZSHWSA-N

SMILES: N(C(C)=O)[C@@H]1[C@@H](O[C@@H](C(O)=O)C)[C@H](O)[C@@]2(O[C@]1(OC2)[H])[H]

Synonyms:

• N-Acetyl-1,6-anhydro-β-muramic acid
• β-Muramic acid, N-acetyl-1,6-anhydro-
• Anhydro-N-acetylmuramic acid

1,6-Anhydro-N-acetyl-β-muramic acid

CAS: 104430-66-2

1,6-Anhydro-N-acetyl-β-muramic acid is a reaction component that can be used in the synthesis of various organic compounds. It is also a reagent that has been used in the synthesis of biologically active compounds. 1,6-Anhydro-N-acetyl-β-muramic acid has been shown to have high purity and a wide range of applications. This chemical is useful as a scaffold for the preparation of complex compounds, as well as being a useful intermediate in the synthesis of fine chemicals or speciality chemicals. 1,6-Anhydro-N-acetyl-β-muramic acid belongs to CAS No. 104430-66-2.

Formula: C₁₁H₁₇NO₇

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 275.26 g/mol

Ref: 3D-MA181741